CAS 1609406-55-4

1H-Benzimidazole, 2-(2-chloroethyl)-6,7-dimethyl-, hydrochloride (1:1)

Description:

1H-Benzimidazole, 2-(2-chloroethyl)-6,7-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a 2-chloroethyl group indicates that it has a chloroalkyl substituent, which can enhance its reactivity and potential biological activity. The 6,7-dimethyl substitutions on the benzimidazole ring contribute to its steric and electronic properties, potentially influencing its interactions with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical applications. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies. Overall, its structural features suggest potential utility in drug development, particularly in areas related to cancer or infectious diseases, but detailed research is necessary to elucidate its full characteristics and applications.

Formula: C₁₁H₁₃ClN₂·ClH

InChI: InChI=1S/C11H13ClN2.ClH/c1-7-3-4-9-11(8(7)2)14-10(13-9)5-6-12;/h3-4H,5-6H2,1-2H3,(H,13,14);1H

InChI key: InChIKey=ITTKFMOKPHZEET-UHFFFAOYSA-N

SMILES: CC1=C2C(N=C(CCCl)N2)=CC=C1C.Cl

Synonyms:

• 1H-Benzimidazole, 2-(2-chloroethyl)-6,7-dimethyl-, hydrochloride (1:1)

2-(2-chloroethyl)-6,7-dimethyl-1H-benzimidazole hydrochloride

CAS: 1609406-55-4

Formula: C₁₁H₁₄Cl₂N₂

Purity: 95.0%

Molecular weight: 245.15

Ref: 10-F308973