CAS 1609406-64-5

Imidazo[1,2-a]pyridine-2-carboxylic acid, 3-bromo-, methyl ester, hydrobromide (1:2)

Description:

Imidazo[1,2-a]pyridine-2-carboxylic acid, 3-bromo-, methyl ester, hydrobromide (1:2) is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both nitrogen-containing heterocycles and a carboxylic acid derivative. The presence of a bromine atom at the 3-position of the imidazo-pyridine ring enhances its reactivity and potential biological activity. As a methyl ester, it features an ester functional group that can undergo hydrolysis to yield the corresponding carboxylic acid. The hydrobromide salt form indicates that the compound is protonated, which may influence its solubility and stability in various solvents. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of new therapeutic agents. Its unique structural features may contribute to interactions with biological targets, making it a candidate for further research in drug discovery and development.

Formula: C₉H₇BrN₂O₂·2BrH

InChI: InChI=1S/C9H7BrN2O2.2BrH/c1-14-9(13)7-8(10)12-5-3-2-4-6(12)11-7;;/h2-5H,1H3;2*1H

InChI key: InChIKey=CJEUOYSJCKPDJK-UHFFFAOYSA-N

SMILES: BrC=1N2C(=NC1C(OC)=O)C=CC=C2.Br

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 3-bromo-, methyl ester, hydrobromide (1:2)

methyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate dihydrobromide

CAS: 1609406-64-5

Formula: C₉H₉Br₃N₂O₂

Purity: 95.0%

Molecular weight: 416.895

Ref: 10-F360571