CAS 1609406-88-3

1,2,4-Oxadiazole-5-methanamine, 3-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-methanamine, 3-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which contributes to its heterocyclic structure and potential biological activity. The presence of the methanamine group suggests it may exhibit basic properties, while the bulky tert-butylphenyl substituent can influence its lipophilicity and steric hindrance, potentially affecting its interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may be of interest in medicinal chemistry due to its structural features, which could impart unique pharmacological properties. Its CAS number, 1609406-88-3, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the combination of its functional groups and structural characteristics positions it as a candidate for further investigation in various chemical and biological contexts.

Formula: C₁₃H₁₇N₃O·ClH

InChI: InChI=1S/C13H17N3O.ClH/c1-13(2,3)10-6-4-9(5-7-10)12-15-11(8-14)17-16-12;/h4-7H,8,14H2,1-3H3;1H

InChI key: InChIKey=PDCPHCMJBMOZOU-UHFFFAOYSA-N

SMILES: C(N)C1=NC(=NO1)C2=CC=C(C(C)(C)C)C=C2.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-methanamine, 3-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1)

{[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl}amine hydrochloride

CAS: 1609406-88-3

Formula: C₁₃H₁₈ClN₃O

Purity: 95.0%

Molecular weight: 267.76

Ref: 10-F361603