CAS 1609407-01-3

1,8-Diazaspiro[4.5]decan-2-one, 1-methyl-, hydrochloride (1:2)

Description:

1,8-Diazaspiro[4.5]decan-2-one, 1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring two nitrogen atoms in the diaza configuration. This compound typically exhibits properties associated with both amines and ketones, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its solubility in polar solvents, which is advantageous for various applications, including pharmaceutical formulations. The presence of the methyl group at the 1-position may influence its pharmacokinetic properties, such as absorption and distribution. Additionally, the compound's spiro structure can impart rigidity, potentially affecting its interaction with biological targets. While specific data on its reactivity and stability may vary, compounds of this class are often investigated for their potential therapeutic effects, particularly in the fields of medicinal chemistry and drug development. As with any chemical substance, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₉H₁₆N₂O·2ClH

InChI: InChI=1S/C9H16N2O.2ClH/c1-11-8(12)2-3-9(11)4-6-10-7-5-9;;/h10H,2-7H2,1H3;2*1H

InChI key: InChIKey=AGUXJZVKQYOFKY-UHFFFAOYSA-N

SMILES: CN1C2(CCC1=O)CCNCC2.Cl

Synonyms:

• 1,8-Diazaspiro[4.5]decan-2-one, 1-methyl-, hydrochloride (1:2)

1-methyl-1,8-diazaspiro[4.5]decan-2-one dihydrochloride

CAS: 1609407-01-3

Formula: C₉H₁₈Cl₂N₂O

Purity: 95.0%

Molecular weight: 241.16

Ref: 10-F360670

1-Methyl-1,8-diazaspiro[4.5]decan-2-one dihydrochloride

CAS: 1609407-01-3

Versatile small molecule scaffold

Formula: C₉H₁₈Cl₂N₂O

Purity: Min. 95%

Molecular weight: 241.16 g/mol

Ref: 3D-JPC40701