CAS 1609407-11-5

3-Piperidinol, 4-[(dimethylamino)methyl]-, hydrochloride (1:2), (3R,4R)-rel-

Description:

3-Piperidinol, 4-[(dimethylamino)methyl]-, hydrochloride (1:2), (3R,4R)-rel- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a hydroxyl group (-OH) at the 3-position and a dimethylaminomethyl group at the 4-position contributes to its unique properties. This compound exists as a hydrochloride salt, indicating that it is protonated and soluble in water, which enhances its bioavailability. The (3R,4R)-rel- designation refers to its specific stereochemistry, indicating that it has a defined three-dimensional arrangement that can influence its biological activity and interactions. Typically, compounds of this nature may exhibit pharmacological properties, potentially acting as intermediates in the synthesis of pharmaceuticals or as active agents themselves. Its molecular interactions, solubility, and stability are influenced by the functional groups present, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₈H₁₈N₂O·2ClH

InChI: InChI=1/C8H18N2O.2ClH/c1-10(2)6-7-3-4-9-5-8(7)11;;/h7-9,11H,3-6H2,1-2H3;2*1H/t7-,8+;;/s2

InChI key: InChIKey=GZKFIPKPONNKJC-RBPSUHOHNA-N

SMILES: C(N(C)C)[C@H]1[C@H](O)CNCC1.Cl

Synonyms:

• 3-Piperidinol, 4-[(dimethylamino)methyl]-, hydrochloride (1:2), (3R,4R)-rel-

(3S,4S)-4-[(dimethylamino)methyl]-3-piperidinol dihydrochloride

CAS: 1609407-11-5

Formula: C₈H₂₀Cl₂N₂O

Purity: 95.0%

Molecular weight: 231.16

Ref: 10-F360538