CAS 1609407-48-8

2-Morpholinemethanamine, 4-(5-chloro-2-benzoxazolyl)-, hydrochloride (1:2)

Description:

2-Morpholinemethanamine, 4-(5-chloro-2-benzoxazolyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include a morpholine ring and a benzoxazole moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility. Its molecular structure suggests potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit properties relevant to drug development. The chloro substituent on the benzoxazole ring may influence its reactivity and interaction with biological targets. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research and development.

Formula: C₁₂H₁₄ClN₃O₂·2ClH

InChI: InChI=1S/C12H14ClN3O2.2ClH/c13-8-1-2-11-10(5-8)15-12(18-11)16-3-4-17-9(6-14)7-16;;/h1-2,5,9H,3-4,6-7,14H2;2*1H

InChI key: InChIKey=IDDWKBLHFFDDEO-UHFFFAOYSA-N

SMILES: C(N)C1CN(C2=NC=3C(O2)=CC=C(Cl)C3)CCO1.Cl

Synonyms:

• 2-Morpholinemethanamine, 4-(5-chloro-2-benzoxazolyl)-, hydrochloride (1:2)

{[4-(5-chloro-1,3-benzoxazol-2-yl)-2-morpholinyl]methyl}amine dihydrochloride

CAS: 1609407-48-8

Formula: C₁₂H₁₆Cl₃N₃O₂

Purity: 95.0%

Molecular weight: 340.63

Ref: 10-F358552