CAS 1609407-49-9

3-Quinolinecarboxylic acid, 4-amino-8-fluoro-, hydrate (1:2)

Description:

3-Quinolinecarboxylic acid, 4-amino-8-fluoro-, hydrate (1:2) is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. The presence of a carboxylic acid functional group (-COOH) indicates its acidic properties, while the amino group (-NH2) contributes to its potential as a building block in pharmaceuticals and organic synthesis. The fluorine atom at the 8-position enhances its biological activity and lipophilicity, making it of interest in medicinal chemistry. The hydrate form suggests that the compound can associate with water molecules, which may influence its solubility and stability. This compound's unique combination of functional groups and structural features may impart specific reactivity and interaction profiles, making it a candidate for further research in drug development or as a chemical intermediate. As with many quinoline derivatives, it may exhibit various biological activities, including antimicrobial or anticancer properties, warranting investigation into its potential applications.

Formula: C₁₀H₇FN₂O₂·2H₂O

InChI: InChI=1S/C10H7FN2O2.2H2O/c11-7-3-1-2-5-8(12)6(10(14)15)4-13-9(5)7;;/h1-4H,(H2,12,13)(H,14,15);2*1H2

InChI key: InChIKey=LYKMCJFMVXAKCE-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=CC1C(O)=O)C(F)=CC=C2.O

Synonyms:

• 3-Quinolinecarboxylic acid, 4-amino-8-fluoro-, hydrate (1:2)

4-amino-8-fluoro-3-quinolinecarboxylic acid dihydrate

CAS: 1609407-49-9

Formula: C₁₀H₁₁FN₂O₄

Purity: 95.0%

Molecular weight: 242.206

Ref: 10-F359978