CAS 1609407-68-2

Piperidine, 4-(4H-1,2,4-triazol-4-yl)-, hydrochloride (1:2)

Description:

Piperidine, 4-(4H-1,2,4-triazol-4-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a 4H-1,2,4-triazole moiety, a five-membered ring containing three nitrogen atoms, which contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of both piperidine and triazole groups suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Its molecular structure and characteristics can influence its reactivity, stability, and interaction with other substances, making it a subject of interest in drug development and chemical research.

Formula: C₇H₁₂N₄·2ClH

InChI: InChI=1S/C7H12N4.2ClH/c1-3-8-4-2-7(1)11-5-9-10-6-11;;/h5-8H,1-4H2;2*1H

InChI key: InChIKey=JBYQNIAHNRQKBD-UHFFFAOYSA-N

SMILES: N1(C=NN=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(4H-1,2,4-triazol-4-yl)-, hydrochloride (1:2)

4-(4H-1,2,4-triazol-4-yl)piperidine dihydrochloride

CAS: 1609407-68-2

Formula: C₇H₁₄Cl₂N₄

Purity: 95.0%

Molecular weight: 225.12

Ref: 10-F360542