CAS 1609407-83-1

2,6-Diazaspiro[3.3]heptane, 2-cyclopropyl-, 2,2,2-trifluoroacetate (1:2)

Description:

2,6-Diazaspiro[3.3]heptane, 2-cyclopropyl-, 2,2,2-trifluoroacetate (1:2) is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring nitrogen atoms. The presence of the cyclopropyl group contributes to its rigidity and may influence its reactivity and interaction with biological systems. The trifluoroacetate moiety enhances the compound's lipophilicity and may affect its solubility and stability in various solvents. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of novel therapeutic agents. Its specific interactions with biological targets can be influenced by the steric and electronic effects of the substituents present in its structure. Additionally, the compound's CAS number, 1609407-83-1, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, the unique structural features of this compound make it a subject of interest for further research in both synthetic and medicinal chemistry.

Formula: C₈H₁₄N₂·2C₂HF₃O₂

InChI: InChI=1S/C8H14N2.C2HF3O2/c1-2-7(1)10-5-8(6-10)3-9-4-8;3-2(4,5)1(6)7/h7,9H,1-6H2;(H,6,7)

InChI key: InChIKey=LEKUHGMDIABYFK-UHFFFAOYSA-N

SMILES: C12(CN(C1)C3CC3)CNC2.C(C(O)=O)(F)(F)F

Synonyms:

• 2-Cyclopropyl-2,6-diazaspiro[3.3]heptane bis(2,2,2-trifluoroacetate)
• 2,6-Diazaspiro[3.3]heptane, 2-cyclopropyl-, 2,2,2-trifluoroacetate (1:2)

2-cyclopropyl-2,6-diazaspiro[3.3]heptane bis(trifluoroacetate)

CAS: 1609407-83-1

Formula: C₁₂H₁₆F₆N₂O₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 366.26

Ref: 10-F401808