CAS 1609407-85-3: 1-Propanol, 3-[[(4-methoxyphenyl)methyl]amino]-, hydrochloride (1:1)

Description:1-Propanol, 3-[[[4-methoxyphenyl)methyl]amino]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a propanol backbone with a methoxyphenyl group and an amino functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the methoxy group suggests potential for aromatic interactions, while the amino group may participate in hydrogen bonding, affecting its reactivity and biological activity. As a hydrochloride, it is likely to be a white crystalline solid at room temperature. The compound may exhibit properties relevant to medicinal chemistry, potentially serving as a precursor or active ingredient in pharmaceutical formulations. Its specific applications and effects would depend on further studies, including its pharmacokinetics, toxicity, and therapeutic efficacy. As with any chemical substance, proper handling and safety measures should be observed, particularly in laboratory or industrial settings.

Formula:C₁₁H₁₇NO₂·ClH

InChI:InChI=1S/C11H17NO2.ClH/c1-14-11-5-3-10(4-6-11)9-12-7-2-8-13;/h3-6,12-13H,2,7-9H2,1H3;1H

InChI key:InChIKey=MYDARCHOHZQGNG-UHFFFAOYSA-N

SMILES:Cl.OCCCNCC1=CC=C(OC)C=C1