CAS 1609407-88-6

1H-Pyrido[4,3-b]indole, 8-fluoro-2,3,4,5-tetrahydro-, hydrobromide (1:1)

Description:

1H-Pyrido[4,3-b]indole, 8-fluoro-2,3,4,5-tetrahydro-, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyridine and indole moieties. This compound features a fluorine atom at the 8-position of the tetrahydro-pyridoindole framework, contributing to its potential biological activity and influencing its physicochemical properties. The hydrobromide salt form indicates that it is combined with hydrobromic acid, which can enhance its solubility in polar solvents and may affect its stability and reactivity. Generally, compounds of this class are of interest in medicinal chemistry due to their potential pharmacological properties, including neuroactivity and interactions with various biological targets. The presence of the tetrahydro configuration suggests that it may exhibit unique stereochemical characteristics, which can influence its binding affinity and selectivity in biological systems. As with many nitrogen-containing heterocycles, this compound may also exhibit interesting electronic properties, making it a candidate for further research in drug development and material science.

Formula: C₁₁H₁₁FN₂·BrH

InChI: InChI=1S/C11H11FN2.BrH/c12-7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10;/h1-2,5,13-14H,3-4,6H2;1H

InChI key: InChIKey=GLUNFNYZJFPCAB-UHFFFAOYSA-N

SMILES: FC=1C=C2C3=C(NC2=CC1)CCNC3.Br

Synonyms:

• 1H-Pyrido[4,3-b]indole, 8-fluoro-2,3,4,5-tetrahydro-, hydrobromide (1:1)

8-fluoro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole hydrobromide

CAS: 1609407-88-6

Formula: C₁₁H₁₂BrFN₂

Purity: 95.0%

Molecular weight: 271.133

Ref: 10-F360807