CAS 1609408-01-6

Carbonic acid, compd. with 4-oxo-3(4H)-quinazolineacetate (1:1)

Description:

Carbonic acid, compd. with 4-oxo-3(4H)-quinazolineacetate (1:1), identified by CAS number 1609408-01-6, is a chemical compound that features a unique combination of carbonic acid and a quinazoline derivative. The presence of carbonic acid suggests that the compound may exhibit acidic properties, potentially influencing its reactivity and solubility in various solvents. The quinazoline moiety is known for its biological activity and can contribute to the compound's pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the structural characteristics of the quinazoline ring, which is often associated with diverse biological activities. Additionally, the 1:1 stoichiometry indicates a balanced interaction between the two components, which may affect the stability and behavior of the compound in different environments. Overall, this compound represents a fascinating area of study for researchers interested in the intersection of organic chemistry and drug development.

Formula: C₁₀H₈N₂O₃·CH₂O₃

InChI: InChI=1S/C10H8N2O3.CH2O3/c13-9(14)5-12-6-11-8-4-2-1-3-7(8)10(12)15;2-1(3)4/h1-4,6H,5H2,(H,13,14);(H2,2,3,4)

InChI key: InChIKey=BYZDCONWONYWAF-UHFFFAOYSA-N

SMILES: O=C1C=2C(N=CN1CC(O)=O)=CC=CC2.C(=O)(O)O

Synonyms:

• (4-oxo-3(4H)-quinazolinyl)acetic acid-carbonic acid (1:1)
• Carbonic acid, compd. with 4-oxo-3(4H)-quinazolineacetate (1:1)

(4-oxo-3(4H)-quinazolinyl)acetic acid - carbonic acid (1:1)

CAS: 1609408-01-6

Formula: C₁₁H₁₀N₂O₆

Purity: 95.0%

Molecular weight: 266.209

Ref: 10-F358625