CAS 1609408-02-7

1H-Pyrazole-4-methanamine, 1-(2-methoxyphenyl)-, hydrochloride (1:2)

Description:

1H-Pyrazole-4-methanamine, 1-(2-methoxyphenyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methanamine group and a 2-methoxyphenyl substituent, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the methoxy group on the phenyl ring may influence its electronic properties and interactions with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, possibly as a lead compound for drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise conditions and environment in which it is studied. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.

Formula: C₁₁H₁₃N₃O·2ClH

InChI: InChI=1S/C11H13N3O.2ClH/c1-15-11-5-3-2-4-10(11)14-8-9(6-12)7-13-14;;/h2-5,7-8H,6,12H2,1H3;2*1H

InChI key: InChIKey=ACAVIYUTOGAHQT-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1)N2C=C(CN)C=N2.Cl

Synonyms:

• 1H-Pyrazole-4-methanamine, 1-(2-methoxyphenyl)-, hydrochloride (1:2)

{[1-(2-methoxyphenyl)-1H-pyrazol-4-yl]methyl}amine dihydrochloride

CAS: 1609408-02-7

Formula: C₁₁H₁₅Cl₂N₃O

Purity: 95.0%

Molecular weight: 276.16

Ref: 10-F358815