CAS 1609408-86-7

Benzenemethanamine, N-cyclopentyl-2,3,4-trimethoxy-, hydrobromide (1:1)

Description:

Benzenemethanamine, N-cyclopentyl-2,3,4-trimethoxy-, hydrobromide (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring, an amine group, and multiple methoxy substituents. The presence of the cyclopentyl group contributes to its unique steric and electronic properties, potentially influencing its reactivity and interactions. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The trimethoxy groups suggest that the compound may exhibit interesting electronic characteristics, possibly affecting its behavior in biological systems. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological activities, although specific biological effects would require further investigation. Overall, its structural features indicate that it could participate in various chemical reactions and interactions, making it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₁₅H₂₃NO₃·BrH

InChI: InChI=1S/C15H23NO3.BrH/c1-17-13-9-8-11(14(18-2)15(13)19-3)10-16-12-6-4-5-7-12;/h8-9,12,16H,4-7,10H2,1-3H3;1H

InChI key: InChIKey=HNAJZDJXOYOQAE-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C(OC)=CC=C1CNC2CCCC2.Br

Synonyms:

• Benzenemethanamine, N-cyclopentyl-2,3,4-trimethoxy-, hydrobromide (1:1)

N-(2,3,4-Trimethoxybenzyl)cyclopentanamine hydrobromide

CAS: 1609408-86-7

Formula: C₁₅H₂₄BrNO₃

Molecular weight: 346.2600

Ref: IN-DA00J3PF

N-(2,3,4-trimethoxybenzyl)cyclopentanamine hydrobromide

CAS: 1609408-86-7

Formula: C₁₅H₂₄BrNO₃

Purity: 95.0%

Molecular weight: 346.265

Ref: 10-F361339