CAS 1609409-11-1

Pyrimidine, 2-methyl-4-(4-piperidinyl)-, hydrochloride (1:2)

Description:

Pyrimidine, 2-methyl-4-(4-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a 4-piperidinyl group enhances its potential biological activity, as piperidine is known for its role in various pharmacological applications. The hydrochloride salt form indicates that the compound is protonated, which typically enhances its solubility in water and may influence its pharmacokinetic properties. This compound may exhibit properties such as being a potential ligand for various receptors or enzymes, making it of interest in medicinal chemistry. Its molecular structure suggests it could be involved in interactions with biological systems, possibly serving as a precursor or intermediate in the synthesis of more complex pharmaceuticals. As with many nitrogen-containing heterocycles, it may also display basicity, allowing it to participate in various chemical reactions. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₀H₁₅N₃·2ClH

InChI: InChI=1S/C10H15N3.2ClH/c1-8-12-7-4-10(13-8)9-2-5-11-6-3-9;;/h4,7,9,11H,2-3,5-6H2,1H3;2*1H

InChI key: InChIKey=HIAAOMSEGPMIHR-UHFFFAOYSA-N

SMILES: CC=1N=C(C=CN1)C2CCNCC2.Cl

Synonyms:

• Pyrimidine, 2-methyl-4-(4-piperidinyl)-, hydrochloride (1:2)

2-methyl-4-(4-piperidinyl)pyrimidine dihydrochloride

CAS: 1609409-11-1

Formula: C₁₀H₁₇Cl₂N₃

Purity: 95.0%

Molecular weight: 250.17

Ref: 10-F360688