CAS 1609409-12-2

3-Piperidinecarboxamide, 3-ethyl-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, 3-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an ethyl group attached to the third carbon of the piperidine ring, along with a carboxamide functional group, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals. The presence of the hydrochloride indicates that the compound can exist in a protonated form, which may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. The compound may exhibit properties typical of piperidine derivatives, including potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and therapeutic applications would require further investigation through experimental studies. As with any chemical substance, proper handling and safety protocols should be observed due to potential hazards associated with its use.

Formula: C₈H₁₆N₂O·ClH

InChI: InChI=1S/C8H16N2O.ClH/c1-2-8(7(9)11)4-3-5-10-6-8;/h10H,2-6H2,1H3,(H2,9,11);1H

InChI key: InChIKey=AHVHOIUVUSKPPM-UHFFFAOYSA-N

SMILES: C(N)(=O)C1(CC)CCCNC1.Cl

Synonyms:

• 3-Piperidinecarboxamide, 3-ethyl-, hydrochloride (1:1)

3-ethyl-3-piperidinecarboxamide hydrochloride

CAS: 1609409-12-2

Formula: C₈H₁₇ClN₂O

Purity: 95.0%

Molecular weight: 192.69

Ref: 10-F360708