CAS 1609409-22-4

1H-Indole-3-ethanamine, N-(3-pyridinylmethyl)-, hydrobromide (1:1)

Description:

1H-Indole-3-ethanamine, N-(3-pyridinylmethyl)-, hydrobromide (1:1) is a chemical compound characterized by its indole and pyridine moieties, which contribute to its biological activity and potential pharmacological properties. The presence of the indole structure suggests that it may interact with various biological targets, including receptors and enzymes, potentially influencing neurotransmitter systems. The hydrobromide salt form indicates that the compound is likely to be more soluble in water, enhancing its bioavailability for research or therapeutic applications. This compound may exhibit properties such as being a potential ligand for certain receptors, and its structural features could suggest roles in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Additionally, the presence of the pyridine ring may impart unique electronic properties, influencing the compound's reactivity and interaction with other molecules. Overall, this compound represents a class of substances that could be of interest in drug discovery and development, particularly in the context of neuropharmacology.

Formula: C₁₆H₁₇N₃·BrH

InChI: InChI=1S/C16H17N3.BrH/c1-2-6-16-15(5-1)14(12-19-16)7-9-18-11-13-4-3-8-17-10-13;/h1-6,8,10,12,18-19H,7,9,11H2;1H

InChI key: InChIKey=XXYBKJCKRWTMLF-UHFFFAOYSA-N

SMILES: C(CNCC=1C=CC=NC1)C=2C=3C(NC2)=CC=CC3.Br

Synonyms:

• 1H-Indole-3-ethanamine, N-(3-pyridinylmethyl)-, hydrobromide (1:1)

[2-(1H-indol-3-yl)ethyl](3-pyridinylmethyl)amine hydrobromide

CAS: 1609409-22-4

Purity: 95.0%

Molecular weight: 332.2449951171875

Ref: 10-F361266