CAS 1609409-30-4

Benzenamine, 2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

Description:

Benzenamine, 2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1), with CAS number 1609409-30-4, is a chemical compound characterized by its complex structure that includes a benzenamine moiety and a 1,2,4-oxadiazole ring. This compound typically appears as a solid, and its hydrochloride form indicates the presence of a hydrochloric acid salt, which enhances its solubility in water. The oxadiazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the 3-methylphenyl group suggests that the compound may exhibit specific electronic and steric properties, influencing its reactivity and interactions with biological targets. As a hydrochloride salt, it is likely to be more stable and easier to handle compared to its free base form. Overall, this compound may be explored for applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with amine compounds.

Formula: C₁₅H₁₃N₃O.ClH

InChI: InChI=1S/C15H13N3O.ClH/c1-10-5-4-6-11(9-10)14-17-15(19-18-14)12-7-2-3-8-13(12)16;/h2-9H,16H2,1H3;1H

InChI key: InChIKey=LLQOLEXVZAZFJG-UHFFFAOYSA-N

SMILES: NC1=C(C2=NC(=NO2)C3=CC(C)=CC=C3)C=CC=C1.Cl

{2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl}amine hydrochloride

CAS: 1609409-30-4

Purity: 95.0%

Molecular weight: 287.75

Ref: 10-F361604