CAS 1609409-35-9

Benzaldehyde, 2-[2-(4-ethyl-1-piperazinyl)ethoxy]-, hydrochloride (1:1)

Description:

Benzaldehyde, 2-[2-(4-ethyl-1-piperazinyl)ethoxy]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzaldehyde moiety and a piperazine derivative. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form. The piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as antimicrobial or psychoactive effects, depending on its specific interactions within biological systems. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety data and handling precautions should be observed, as with many organic compounds, due to potential toxicity or irritant properties. Overall, this compound represents a unique combination of functional groups that may lend itself to diverse applications in pharmaceuticals or chemical research.

Formula: C₁₅H₂₂N₂O₂·ClH

InChI: InChI=1S/C15H22N2O2.ClH/c1-2-16-7-9-17(10-8-16)11-12-19-15-6-4-3-5-14(15)13-18;/h3-6,13H,2,7-12H2,1H3;1H

InChI key: InChIKey=LMEIHQPJQHADOL-UHFFFAOYSA-N

SMILES: O(CCN1CCN(CC)CC1)C2=C(C=O)C=CC=C2.Cl

Synonyms:

• Benzaldehyde, 2-[2-(4-ethyl-1-piperazinyl)ethoxy]-, hydrochloride (1:1)

2-[2-(4-ethyl-1-piperazinyl)ethoxy]benzaldehyde hydrochloride

CAS: 1609409-35-9

Formula: C₁₅H₂₃ClN₂O₂

Purity: 95.0%

Molecular weight: 298.81

Ref: 10-F361580