CAS 1609409-37-1

Benzaldehyde, 2-[4-(1H-imidazol-1-yl)butoxy]-, hydrochloride (1:1)

Description:

Benzaldehyde, 2-[4-(1H-imidazol-1-yl)butoxy]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzaldehyde moiety and an imidazole group linked through a butoxy chain. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting the presence of both hydrophobic and hydrophilic components in its structure. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound may exhibit various properties such as antimicrobial or antifungal activity, depending on its specific interactions with biological targets. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a blend of organic functional groups that may lend itself to diverse applications in research and pharmaceuticals.

Formula: C₁₄H₁₆N₂O₂·ClH

InChI: InChI=1S/C14H16N2O2.ClH/c17-11-13-5-1-2-6-14(13)18-10-4-3-8-16-9-7-15-12-16;/h1-2,5-7,9,11-12H,3-4,8,10H2;1H

InChI key: InChIKey=NGSYNZMOEIRROS-UHFFFAOYSA-N

SMILES: O(CCCCN1C=CN=C1)C2=C(C=O)C=CC=C2.Cl

Synonyms:

• Benzaldehyde, 2-[4-(1H-imidazol-1-yl)butoxy]-, hydrochloride (1:1)

2-[4-(1H-imidazol-1-yl)butoxy]benzaldehyde hydrochloride

CAS: 1609409-37-1

Formula: C₁₄H₁₇ClN₂O₂

Purity: 95.0%

Molecular weight: 280.75

Ref: 10-F361739