CAS 16096-32-5
:4-Methylindole
Description:
4-Methylindole, also known as 4-methyl-1H-indole, is an organic compound characterized by its indole structure with a methyl group attached to the fourth carbon of the indole ring. It has a molecular formula of C9H9N and a molecular weight of approximately 145.17 g/mol. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. 4-Methylindole is known for its aromatic properties and is often used in the synthesis of various chemical compounds, including pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. Additionally, 4-Methylindole has been studied for its biological activities, including potential roles in signaling pathways and as a precursor in the synthesis of more complex molecules. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 4-Methylindole is a significant compound in organic chemistry with various applications in research and industry.
Formula:C9H9N
InChI:InChI=1S/C9H9N/c1-7-3-2-4-9-8(7)5-6-10-9/h2-6,10H,1H3
InChI key:InChIKey=PZOUSPYUWWUPPK-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC=C1)NC=C2
Synonyms:- 1H-Indole, 4-methyl-
- 4-Methylindolettp
- 4-methyl-1H-indole
- 5-Chloro-2-fluorobenzyl alcohol
- Akos Jy2082555
- Indole, 4-methyl-
- 4-Methylindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Methylindole
CAS:Formula:C9H9NPurity:>98.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:131.184-Methyl-1H-indole
CAS:4-Methyl-1H-indoleFormula:C9H9NPurity:techColor and Shape: turbid brown liquid liquidMolecular weight:131.17g/mol4-Methylindole
CAS:4-Methylindole is a versatile building block that can be used to synthesize a variety of complex compounds.Formula:C9H9NPurity:Min. 98.0 Area-%Molecular weight:131.18 g/mol4-Methylindole
CAS:4-Methylindole is an anthranilic acid derivative that inhibits the polymerase chain reaction (PCR) by binding to the polymerase and preventing DNA replication. 4-Methylindole has been shown to inhibit the production of human liver proteins in vitro, but its effects on other tissues have not been determined. 4-Methylindole is a low toxicity compound that is metabolized by hydrolysis, which can be reversed with acid or base. It also binds to and irreversibly oxidizes human protein, which may be due to its reversible oxidation properties. This chemical has been found in capsicum annuum, which produces it as a natural defense against herbivores.Formula:C9H9NPurity:Min. 95%Color and Shape:LiquidMolecular weight:131.17 g/mol





