CymitQuimica logo

CAS 160969-00-6

:

1-(2-Bromo-ethoxy)-2-(2,2,2,trifluro ethoxy)benzene

Description:
1-(2-Bromo-ethoxy)-2-(2,2,2-trifluoroethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two distinct ethoxy groups. One of these groups contains a bromine atom, while the other features three fluorine atoms, contributing to the compound's unique chemical properties. The presence of the bromine atom can enhance reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The trifluoroethoxy group imparts significant electronegativity, affecting the compound's polarity and solubility in different solvents. This compound may exhibit interesting biological activities due to its halogenated substituents, which can influence interactions with biological targets. Additionally, the presence of fluorine atoms often enhances metabolic stability and lipophilicity, making such compounds of interest in medicinal chemistry and material science. Overall, the combination of bromine and trifluoromethyl groups in the ethoxy substituents contributes to the compound's distinctive chemical behavior and potential applications.
Formula:C10H10BrF3O2
InChI:InChI=1/C10H10BrF3O2/c11-5-6-15-8-3-1-2-4-9(8)16-7-10(12,13)14/h1-4H,5-7H2
InChI key:BPRQLNDSURZFSX-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)OCCBr)OCC(F)(F)F
Synonyms:
  • 2-[2-(2,2,2-Trifluoroethoxy)Phenoxy]Ethyl Bromide
  • 1-(2-Bromoethoxy)-2-(2,2,2-Trifluoroethoxy)Benzene
Found 5 products.