CAS 16097-64-6
:2,4-dichloro-6-(trifluoromethyl)pyrimidine
Description:
2,4-Dichloro-6-(trifluoromethyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms and a trifluoromethyl group. The presence of the dichloro substituents at the 2 and 4 positions, along with the trifluoromethyl group at the 6 position, contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound is typically a solid at room temperature and is known for its stability under various conditions. It is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its ability to act as a building block in the formation of more complex molecules. Additionally, the presence of halogen atoms can enhance its reactivity in nucleophilic substitution reactions. Safety data indicates that it should be handled with care, as it may pose environmental and health risks. Overall, 2,4-dichloro-6-(trifluoromethyl)pyrimidine is a valuable compound in chemical research and industrial applications.
Formula:C5HCl2F3N2
InChI:InChI=1/C5HCl2F3N2/c6-3-1-2(5(8,9)10)11-4(7)12-3/h1H
SMILES:c1c(C(F)(F)F)nc(Cl)nc1Cl
Synonyms:- Pyrimidine, 2,4-Dichloro-6-(Trifluoromethyl)-
- 2,4-Dichloro-6-(trifluoromethyl)pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Dichloro-6-(trifluoromethyl)pyrimidine , 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5HCl2F3N2Purity:95%Molecular weight:216.97Pyrimidine, 2,4-dichloro-6-(trifluoromethyl)-
CAS:Formula:C5HCl2F3N2Purity:98%Color and Shape:LiquidMolecular weight:216.97602,4-Dichloro-6-(trifluoromethyl)pyrimidine
CAS:2,4-Dichloro-6-(trifluoromethyl)pyrimidinePurity:98%Color and Shape:LiquidMolecular weight:216.98g/mol2,4-Dichloro-6-(trifluoromethyl)pyrimidine
CAS:Formula:C5HCl2F3N2Purity:95%Color and Shape:LiquidMolecular weight:216.97



