CAS 16098-20-7

6-Bromo-8-nitrotetrazolo[1,5-a]pyridine

Description:

6-Bromo-8-nitrotetrazolo[1,5-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes a pyridine ring fused with a tetrazole moiety. The presence of bromine and nitro groups introduces significant reactivity and polarity to the molecule. This compound typically exhibits a range of physical properties, including a specific melting point and solubility characteristics that depend on the solvent used. It is often utilized in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to participate in further chemical reactions. The nitro group can serve as a site for reduction reactions, while the bromine atom can be involved in nucleophilic substitution reactions. Additionally, the compound's unique structure may contribute to its pharmacological properties, making it of interest for research into new therapeutic agents. Safety data should be consulted, as compounds with nitro and halogen substituents can pose hazards in terms of toxicity and environmental impact.

Formula: C₅H₂BrN₅O₂

InChI: InChI=1S/C5H2BrN5O2/c6-3-1-4(11(12)13)5-7-8-9-10(5)2-3/h1-2H

InChI key: InChIKey=NXTXSMJQRBVECE-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2N(C=C(Br)C1)N=NN2

Synonyms:

• 6-Bromo-8-nitrotetrazolo[1,5-a]pyridine
• Tetrazolo[1,5-a]pyridine, 6-bromo-8-nitro-
• Tetrazolopyridine, 6-bromo-8-nitro-

6-Bromo-8-Nitrotetrazolo[1,5-A]Pyridine

CAS: 16098-20-7

Formula: C₅H₂BrN₅O₂

Molecular weight: 244.0057

Ref: IN-DA001VKQ

6-Bromo-8-nitrotetrazolo[1,5-a]pyridine

CAS: 16098-20-7

6-Bromo-8-nitrotetrazolo[1,5-a]pyridine

Purity: ≥95%

Molecular weight: 244.01g/mol

Ref: 54-OR11989