CAS 160984-14-5

2-(4-Acetylphenoxy)acetonitrile

Description:

2-(4-Acetylphenoxy)acetonitrile, with the CAS number 160984-14-5, is an organic compound characterized by its functional groups, which include an acetonitrile moiety and an acetylphenoxy group. This compound typically appears as a solid or liquid at room temperature, depending on its specific formulation and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the acetyl group contributes to its reactivity, allowing for various chemical transformations. Additionally, the phenoxy group enhances its solubility in organic solvents, making it useful in various chemical processes. The compound's structure suggests it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Safety data should be consulted to understand its handling requirements, as it may pose risks typical of organic nitriles, including toxicity and flammability. Overall, 2-(4-Acetylphenoxy)acetonitrile is a versatile compound with significant potential in chemical research and industry.

Formula: C₁₀H₉NO₂

InChI: InChI=1S/C10H9NO2/c1-8(12)9-2-4-10(5-3-9)13-7-6-11/h2-5H,7H2,1H3

InChI key: InChIKey=LMPOOCSNZQWRBX-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC=C(OCC#N)C=C1

Synonyms:

• (4-Acetylphenoxy)acetonitrile
• Acetonitrile, (4-acetylphenoxy)-
• Acetonitrile, 2-(4-acetylphenoxy)-
• 2-(4-Acetylphenoxy)acetonitrile

2-(4-Acetylphenoxy)acetonitrile

CAS: 160984-14-5

Versatile small molecule scaffold

Formula: C₁₀H₉NO₂

Purity: Min. 95%

Molecular weight: 175.18 g/mol

Ref: 3D-KGA98414