CAS 160989-35-5
:N-TRITYL-2,3-DIBROMOMALEIMIDE
Description:
N-Trityl-2,3-dibromomaleimide is a synthetic organic compound characterized by its unique structure, which includes a maleimide core substituted with bromine atoms and a trityl group. The presence of the dibromo substituents enhances its reactivity, making it useful in various chemical applications, particularly in organic synthesis and polymer chemistry. The trityl group, known for its stability and ability to protect functional groups, contributes to the compound's overall stability and solubility in organic solvents. This compound is typically utilized in the preparation of functionalized polymers and as a reagent in chemical reactions, including those involving nucleophilic additions. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to its brominated nature. Overall, N-Trityl-2,3-dibromomaleimide is a valuable compound in the field of synthetic organic chemistry.
Formula:C23H15Br2NO2
InChI:InChI=1/C23H15Br2NO2/c24-19-20(25)22(28)26(21(19)27)23(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)N1C(=O)C(=C(C1=O)Br)Br
Synonyms:- 1H-pyrrole-2,5-dione, 3,4-dibromo-1-(triphenylmethyl)-
- 3,4-Dibromo-1-trityl-1H-pyrrole-2,5-dione
- 3,4-Dibromo-1-Trityl-Pyrrole-2,5-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
