CAS 161024-80-2
:(R)-N-BOC-3-Amino-3-phenylpropanoic acid
Description:
(R)-N-BOC-3-Amino-3-phenylpropanoic acid is a chiral amino acid derivative characterized by the presence of a tert-butyloxycarbonyl (BOC) protecting group on the amino group, which enhances its stability and solubility in organic solvents. This compound features a phenyl group attached to the central carbon, contributing to its aromatic properties and influencing its interactions in biochemical contexts. The presence of the carboxylic acid functional group allows it to participate in various chemical reactions, including peptide synthesis. As a chiral molecule, it exists in two enantiomeric forms, with the (R) configuration being significant in pharmaceutical applications, where stereochemistry can affect biological activity. The compound is typically used in organic synthesis and medicinal chemistry, particularly in the development of peptide-based drugs. Its solubility profile and reactivity make it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper laboratory practices.
Formula:C14H19NO4
InChI:InChI=1/C14H19NO4/c1-14(2,3)19-13(18)15-11(9-12(16)17)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/t11-/m1/s1
SMILES:CC(C)(C)OC(=N[C@H](CC(=O)O)c1ccccc1)O
Synonyms:- (R)-N-BOC-beta-phenyl-beta-alanine
- (R)-N-tert-Butoxycarbonyl-3-amino-3-phenylpropanoic acid
- Boc-beta-Phe-OH
- Boc-(R)-3-amino-3-phenylpropionic acid
- Boc-D-3-Amino-3-phenylpropionic acid
- (3R)-3-[(tert-butoxycarbonyl)amino]-3-phenylpropanoate
- (3R)-3-[(tert-butoxycarbonyl)amino]-3-phenylpropanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-3-(Boc-amino)-3-phenylpropionic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H19NO4Purity:95%Molecular weight:265.31Benzenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βR)-
CAS:Formula:C14H19NO4Purity:97%Color and Shape:SolidMolecular weight:265.3050Boc-(R)-3-Amino-3-phenylpropionic acid
CAS:Boc-(R)-3-Amino-3-phenylpropionic acidPurity:97%Molecular weight:265.30g/mol(R)-3-((tert-Butoxycarbonyl)amino)-3-phenylpropanoic acid
CAS:Formula:C14H19NO4Purity:97%Color and Shape:SolidMolecular weight:265.309




