CAS 1610376-98-1

Piperazine, 1-[[1-(3-fluoro-4-methoxyphenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2)

Description:

Piperazine, 1-[[1-(3-fluoro-4-methoxyphenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a triazole moiety, specifically a 1,2,3-triazole, which is known for its stability and ability to form hydrogen bonds, enhancing its potential biological activity. The presence of a 3-fluoro-4-methoxyphenyl group suggests that it may exhibit unique electronic properties and lipophilicity, influencing its interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water, facilitating its use in pharmaceutical applications. The compound may possess various pharmacological properties, potentially acting as an antimicrobial or anticancer agent, although specific biological activities would need to be confirmed through empirical studies. Overall, its structural features indicate a compound of interest in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₄H₁₈FN₅O·2ClH

InChI: InChI=1S/C14H18FN5O.2ClH/c1-21-14-3-2-11(8-13(14)15)20-12(9-17-18-20)10-19-6-4-16-5-7-19;;/h2-3,8-9,16H,4-7,10H2,1H3;2*1H

InChI key: InChIKey=INICEZBPBNRZSY-UHFFFAOYSA-N

SMILES: C(C=1N(N=NC1)C2=CC(F)=C(OC)C=C2)N3CCNCC3.Cl

Synonyms:

• Piperazine, 1-[[1-(3-fluoro-4-methoxyphenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2)

1-{[1-(3-Fluoro-4-methoxyphenyl)-1H-1,2,3-triazol-5-yl]methyl}piperazine dihydrochloride

CAS: 1610376-98-1

1-{[1-(3-Fluoro-4-methoxyphenyl)-1H-1,2,3-triazol-5-yl]methyl}piperazine dihydrochloride

Purity: ≥95%

Molecular weight: 364.25g/mol

Ref: 54-PC200480