CAS 1610377-00-8

3-Piperidinecarboxylic acid, 1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)-

Description:

3-Piperidinecarboxylic acid, 1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)- is a chemical compound characterized by its complex structure, which includes a piperidine ring and a tetrahydropyrazinoindazole moiety. This compound features a carboxylic acid functional group, which contributes to its acidity and potential for forming salts or esters. The presence of the piperidine ring suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The tetrahydropyrazinoindazole component indicates potential biological activity, as many compounds with similar structures are investigated for pharmacological properties. The compound's molecular interactions may be influenced by its stereochemistry and functional groups, making it a candidate for research in medicinal chemistry. Its CAS number, 1610377-00-8, allows for easy identification in chemical databases, facilitating further studies on its synthesis, reactivity, and potential applications in drug development or other fields.

Formula: C₁₆H₂₀N₄O₂

InChI: InChI=1S/C16H20N4O2/c21-16(22)11-4-3-8-19(10-11)15-14-12-5-1-2-6-13(12)18-20(14)9-7-17-15/h7,9,11H,1-6,8,10H2,(H,21,22)

InChI key: InChIKey=SEGWDKUGXPSWJM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CN(C=2C3=C4C(=NN3C=CN2)CCCC4)CCC1

Synonyms:

• 1-(7,8,9,10-Tetrahydropyrazino[1,2-b]indazol-1-yl)-3-piperidinecarboxylic acid
• 3-Piperidinecarboxylic acid, 1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)-

1-(7,8,9,10-Tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxylic acid

CAS: 1610377-00-8

1-(7,8,9,10-Tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxylic acid

Purity: ≥95%

Molecular weight: 300.36g/mol

Ref: 54-OR310702