CAS 1610377-07-5

Piperazine, 1-[[1-(2-chlorophenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2)

Description:

Piperazine, 1-[[1-(2-chlorophenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a triazole ring substituted with a 2-chlorophenyl group, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is often desirable for pharmaceutical applications. The presence of the triazole moiety suggests potential antifungal or antimicrobial properties, as triazoles are known for their role in inhibiting fungal cytochrome P450 enzymes. The compound's structure may also imply interactions with various biological targets, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Overall, this compound represents a class of substances that may have therapeutic applications, warranting further investigation into its pharmacological properties.

Formula: C₁₃H₁₆ClN₅·2ClH

InChI: InChI=1S/C13H16ClN5.2ClH/c14-12-3-1-2-4-13(12)19-11(9-16-17-19)10-18-7-5-15-6-8-18;;/h1-4,9,15H,5-8,10H2;2*1H

InChI key: InChIKey=PAUSGSVZWMLTNL-UHFFFAOYSA-N

SMILES: C(C=1N(N=NC1)C2=C(Cl)C=CC=C2)N3CCNCC3.Cl

Synonyms:

• Piperazine, 1-[[1-(2-chlorophenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2)

1-{[1-(2-Chlorophenyl)-1H-1,2,3-triazol-5-yl]methyl}piperazine dihydrochloride

CAS: 1610377-07-5

1-{[1-(2-Chlorophenyl)-1H-1,2,3-triazol-5-yl]methyl}piperazine dihydrochloride

Purity: ≥95%

Molecular weight: 350.67g/mol

Ref: 54-OR310731