CAS 1610377-13-3

Piperazine, 1-[[1-(2-methylphenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2)

Description:

Piperazine, 1-[[1-(2-methylphenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a triazole ring, specifically a 1,2,3-triazole, which is known for its stability and ability to form hydrogen bonds, enhancing its potential biological activity. The presence of the 2-methylphenyl group contributes to its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit diverse biological activities, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions and mechanisms of action would depend on the structural features and functional groups present, which could influence its binding affinity to biological targets. Overall, this compound represents a unique combination of piperazine and triazole chemistry, with potential implications in drug discovery and development.

Formula: C₁₄H₁₉N₅·2ClH

InChI: InChI=1S/C14H19N5.2ClH/c1-12-4-2-3-5-14(12)19-13(10-16-17-19)11-18-8-6-15-7-9-18;;/h2-5,10,15H,6-9,11H2,1H3;2*1H

InChI key: InChIKey=XSCWRNSORYXTGL-UHFFFAOYSA-N

SMILES: C(C=1N(N=NC1)C2=C(C)C=CC=C2)N3CCNCC3.Cl

Synonyms:

• Piperazine, 1-[[1-(2-methylphenyl)-1H-1,2,3-triazol-5-yl]methyl]-, hydrochloride (1:2)

1-{[1-(2-Methylphenyl)-1H-1,2,3-triazol-5-yl]methyl}piperazine dihydrochloride

CAS: 1610377-13-3

1-{[1-(2-Methylphenyl)-1H-1,2,3-triazol-5-yl]methyl}piperazine dihydrochloride

Purity: ≥95%

Molecular weight: 330.26g/mol

Ref: 54-OR310737