CAS 16105-69-4

2-Amino-1-hydroxy-3-octadecanone

Description:

2-Amino-1-hydroxy-3-octadecanone, with the CAS number 16105-69-4, is an organic compound characterized by its long hydrocarbon chain and functional groups. It features an amino group (-NH2), a hydroxyl group (-OH), and a ketone group (C=O) within its structure, which contribute to its reactivity and potential applications. The presence of the octadecanone backbone indicates that it is a fatty acid derivative, which may impart hydrophobic properties while also allowing for hydrogen bonding due to the hydroxyl and amino groups. This compound is likely to be a solid at room temperature due to its long carbon chain, and it may exhibit surfactant properties, making it useful in various biochemical and industrial applications. Additionally, its functional groups suggest potential for biological activity, possibly influencing its role in metabolic processes or as a precursor in synthetic pathways. Overall, 2-Amino-1-hydroxy-3-octadecanone is a versatile compound with significant implications in both chemistry and biochemistry.

Formula: C₁₈H₃₇NO₂

InChI: InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17,20H,2-16,19H2,1H3

InChI key: InChIKey=KBUNOSOGGAARKZ-UHFFFAOYSA-N

SMILES: C(CCCCCCCCCCCCCC)C(C(CO)N)=O

Synonyms:

• 2-Amino-1-hydroxyoctadecan-3-one
• 2-Amino-1-hydroxy-3-octadecanone
• 3-Octadecanone, 2-amino-1-hydroxy-
• Ketodihydrosphingosine
• 3-Ketodihydrosphingosine

3-Octadecanone, 2-amino-1-hydroxy-

CAS: 16105-69-4

Formula: C₁₈H₃₇NO₂

Molecular weight: 299.4919

Ref: IN-DA001VM2