CymitQuimica logo

CAS 1610527-49-5

:

(2,4-dimethylphenyl)(2-nitrophenyl)sulfane

Description:
(2,4-Dimethylphenyl)(2-nitrophenyl)sulfane is an organic compound characterized by the presence of a sulfane functional group, which indicates the presence of sulfur bonded to two aromatic rings. The compound features a dimethyl-substituted phenyl group and a nitro-substituted phenyl group, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity due to its electron-withdrawing nature, while the dimethyl groups can influence steric hindrance and electronic effects. This compound may exhibit moderate solubility in organic solvents, and its stability can be affected by the substituents on the aromatic rings. Additionally, the presence of sulfur in the structure may impart specific characteristics such as potential for coordination with metals or participation in redox reactions. Overall, (2,4-dimethylphenyl)(2-nitrophenyl)sulfane is of interest in various chemical applications, including synthesis and materials science, due to its unique structural features and reactivity.
Formula:C14H13NO2S
InChI:InChI=1S/C14H13NO2S/c1-10-7-8-13(11(2)9-10)18-14-6-4-3-5-12(14)15(16)17/h3-9H,1-2H3
InChI key:SHBWPKLGXVSPIP-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1)SC2=CC=CC=C2[N+](=O)[O-])C
Synonyms:
  • 2,4-Dimethyl-1-[(2-Nitro-Phenyl)-Sulfanyl]-Benzene
  • (2,4-Dimethyiphenyl)(2-Nitrophenyl)Sulfane
Found 6 products.