CAS 16106-38-0
:Benzoyl chloride, 4-amino- (9CI)
Description:
Benzoyl chloride, 4-amino- (9CI), with the CAS number 16106-38-0, is an organic compound characterized by the presence of both an amine and an acyl chloride functional group. It typically appears as a colorless to pale yellow liquid with a pungent odor. This compound is known for its reactivity, particularly due to the electrophilic nature of the carbonyl carbon in the acyl chloride group, making it a useful intermediate in organic synthesis. It can participate in various chemical reactions, including acylation and amidation, allowing for the introduction of benzoyl groups into other molecules. The presence of the amino group also imparts basic properties, enabling it to form salts with acids. However, benzoyl chloride, 4-amino- is sensitive to moisture and can hydrolyze in the presence of water, releasing hydrochloric acid. Safety precautions are necessary when handling this compound, as it can be corrosive and irritating to the skin, eyes, and respiratory system.
Formula:C7H6ClNO
InChI:InChI=1/C7H6ClNO/c8-7(10)5-1-3-6(9)4-2-5/h1-4H,9H2
SMILES:c1cc(ccc1C(=O)Cl)N
Synonyms:- Benzoyl chloride, 4-amino-
- 4-Aminobenzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
