CAS 16108-03-5
:N-formyl-dl-tryptophan
Description:
N-formyl-dl-tryptophan is an amino acid derivative characterized by the presence of a formyl group attached to the nitrogen of the indole side chain of tryptophan. This compound is a racemic mixture, meaning it contains equal parts of both the D- and L- enantiomers. It is typically a white to off-white solid and is soluble in polar solvents such as water and methanol, which facilitates its use in various biochemical applications. N-formyl-dl-tryptophan is often studied for its role in peptide synthesis and as a potential intermediate in the production of pharmaceuticals. Its structure allows it to participate in various chemical reactions, including acylation and amidation. Additionally, due to the presence of the indole moiety, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C12H12N2O3
InChI:InChI=1/C12H12N2O3/c15-7-14-11(12(16)17)5-8-6-13-10-4-2-1-3-9(8)10/h1-4,6-7,11,13H,5H2,(H,14,15)(H,16,17)
SMILES:c1ccc2c(c1)c(CC(C(=O)O)N=CO)c[nH]2
Synonyms:- Formyltryptophan
- N-formyltryptophan
- For-DL-Trp-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Formyl-DL-Trp-OH
CAS:Formyl-DL-Trp-OH is a hydrophobic, noncompetitive inhibitor of n-acetyl-dl-tryptophan synthase. It has been shown to bind to human albumin and erythrocyte membranes. Formyl-DL-Trp-OH is also an inhibitor of the enzyme amide hydrolysis in the metabolism of tryptophan. This drug can be used as a substrate in clinical chemistry for measuring amide hydrolysis. The binding constants of this compound have been determined using ultraviolet absorption and hydrogen bond measurements. This drug can be used in chromatographic methods to separate n-acetyl-dl-tryptophan from other related compounds in urine samples.Formula:C12H12N2O3Purity:Min. 95%Molecular weight:232.24 g/mol



