CAS 161091-55-0
:2-AMINO-1,5,6-TRIMETHYLIMIDAZO(4,5-B)PYRIDINE
Description:
2-Amino-1,5,6-trimethylimidazo(4,5-b)pyridine, with the CAS number 161091-55-0, is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings. This compound features three methyl groups and an amino group, contributing to its unique chemical properties. It is known for its potential biological activity and has been studied for its role in the formation of mutagenic compounds, particularly in cooked meats. The presence of the amino group enhances its reactivity, making it a subject of interest in medicinal chemistry and toxicology. Its structure allows for various interactions with biological macromolecules, which may influence its pharmacological properties. Additionally, the compound's stability and solubility can vary based on environmental conditions, affecting its behavior in biological systems. Overall, 2-amino-1,5,6-trimethylimidazo(4,5-b)pyridine serves as an important model for understanding the implications of heterocyclic amines in food chemistry and their potential health effects.
Formula:C9H12N4
InChI:InChI=1/C9H12N4/c1-5-4-7-8(11-6(5)2)12-9(10)13(7)3/h4H,1-3H3,(H2,10,11,12)
SMILES:Cc1cc2c(nc1C)[nH]c(=N)n2C
Synonyms:- 1H-Imidazo(4,5-b)pyridin-2-amine, trimethyl-
- Trimethyl-1H-imidazo(4,5-b)pyridin-2-amine
- 1,5,6-trimethyl-1H-imidazo[4,5-b]pyridin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Amino-1,5,6-trimethylimidazo [4,5-b] Pyridine
CAS:Formula:C9H12N4Color and Shape:SolidMolecular weight:176.21842-Amino-1,5,6-trimethylimidazo [4,5-b] Pyridine
CAS:Controlled ProductApplications A potential food mutagen.
References Borgen, E., et al.: Food Chem., 74, 11 (2001), Busquets, R., et al.: J. Agric. Food Chem., 54, 8376 (2006), Knize, M., et al.: Environ. Mol. Mutagen., 47, 226 (2006),Formula:C9H12N4Color and Shape:NeatMolecular weight:176.22


