CAS 1611-83-2
:N-Phenylmethacrylamide
Description:
N-Phenylmethacrylamide (CAS 1611-83-2) is an organic compound that belongs to the class of methacrylamides, characterized by the presence of a methacrylic acid derivative with a phenyl group attached to the nitrogen atom. This compound typically appears as a white to light yellow crystalline solid and is soluble in organic solvents such as acetone and chloroform, but has limited solubility in water. N-Phenylmethacrylamide is known for its ability to undergo polymerization, making it useful in the synthesis of various copolymers and polymeric materials. The presence of the phenyl group contributes to its unique properties, including enhanced thermal stability and potential applications in the production of specialty polymers, coatings, and adhesives. Additionally, it exhibits moderate toxicity, necessitating appropriate handling and safety precautions during use. Overall, N-Phenylmethacrylamide is a versatile compound with significant relevance in materials science and polymer chemistry.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c1-8(2)10(12)11-9-6-4-3-5-7-9/h3-7H,1H2,2H3,(H,11,12)
InChI key:InChIKey=IJSVVICYGLOZHA-UHFFFAOYSA-N
SMILES:N(C(C(C)=C)=O)C1=CC=CC=C1
Synonyms:- 2-Methyl-N-phenyl-2-propenamide
- 2-Methyl-N-phenylacrylamide
- 2-Methylacrylanilide
- 2-Propenamide, 2-methyl-N-phenyl-
- 2-methyl-N-phenylprop-2-enamide
- Methacrylanilide
- NSC 32640
- α-Methylacrylanilide
- N-Phenylmethacrylamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Phenylmethacrylamide
CAS:Formula:C10H11NOPurity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:161.202-Propenamide, 2-methyl-N-phenyl-
CAS:Formula:C10H11NOPurity:99%Color and Shape:SolidMolecular weight:161.20042-Methyl-N-phenylprop-2-enamide
CAS:2-Methyl-N-phenylprop-2-enamidePurity:99%Molecular weight:161.20g/molN-Phenylmethacrylamide
CAS:N-Phenylmethacrylamide is a cross-linking agent that is used in the preparation of polymers. It reacts with amine groups to form amides, which are then reacted with sodium salts to form polyamides. The amide group can also be used for synthesizing polyurethanes and other polymers. N-Phenylmethacrylamide is soluble in organic solvents and has low toxicity. It can be activated by radiation or by reaction with a hydroxyl group and forms a bond by hydrogen bonding with other functional groups, such as hydroxyls, carbonyls, nitrogens, and sulphurs. This compound can be used as an effective chemotherapy drug because it binds to DNA strands and inhibits the synthesis of RNA and protein in cells.
Formula:C10H11NOPurity:Min. 95%Molecular weight:161.2 g/mol




