CAS 161118-67-8
:BTPP
Description:
BTPP, or bis(2,4,6-trimethylphenyl)phosphate, is an organophosphate compound characterized by its phosphate functional group attached to two bulky trimethylphenyl groups. This structure imparts unique properties, including high thermal stability and potential applications as a flame retardant and plasticizer. BTPP is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is known for its low volatility and relatively high molecular weight, which contribute to its effectiveness in various industrial applications. Additionally, BTPP exhibits moderate solubility in organic solvents, making it suitable for incorporation into various polymer matrices. However, like many organophosphates, it may pose environmental and health concerns, necessitating careful handling and assessment of its toxicity and biodegradability. Overall, BTPP's distinctive chemical structure and properties make it a subject of interest in materials science and chemical engineering.
Formula:C16H33N4P
InChI:InChI=1/C16H33N4P/c1-16(2,3)17-21(18-10-4-5-11-18,19-12-6-7-13-19)20-14-8-9-15-20/h4-15H2,1-3H3
SMILES:CC(C)(C)N=P(N1CCCC1)(N1CCCC1)N1CCCC1
Synonyms:- Tert-Butylimino-Tri(Pyrrolidino)Phosphorane
- Phosphazene Base P1-T-Bu-Tris(Tetramethylene)
- Labotest-Bb Lt00847568
- tert-Butylimino-tri(pyrrolidino)phosphorane, BTPP
- 1-(N-tert-butyl-P,P-dipyrrolidin-1-ylphosphorimidoyl)pyrrolidine
- (tert-Butylimino)tris(pyrrolidino)phosphorane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Propanamine, 2-methyl-N-(tri-1-pyrrolidinylphosphoranylidene)-
CAS:Formula:C16H33N4PPurity:97%Color and Shape:LiquidMolecular weight:312.4338Ref: IN-DA001S6V
1g126.00€5g213.00€10g522.00€25gTo inquire50gTo inquire100gTo inquire100mg56.00€250mg72.00€N-Tert-Butyl-1,1,1-Tri(Pyrrolidin-1-Yl)-l5-Phosphanimine
CAS:N-Tert-Butyl-1,1,1-Tri(Pyrrolidin-1-Yl)-l5-PhosphaniminePurity:98%Molecular weight:312.43g/mol(tert-Butylimino)tris(pyrrolidino)phosphorane
CAS:Please enquire for more information about (tert-Butylimino)tris(pyrrolidino)phosphorane including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C16H33N4PMolecular weight:312.43 g/molRef: 3D-J-009787
10gTo inquire25gTo inquire50gTo inquire100gTo inquire250gTo inquire-Unit-ggTo inquireBTPP
CAS:<p>(tert-Butylimino)tris(pyrrolidino)phosphorane is a macrocyclic phosphorane that exhibits antioxidant properties. It has been shown to protect against syncytial virus infection and cancer cell growth. This compound also has the ability to inhibit energy metabolism, which may be due to its ability to bind metal hydroxides. (tert-Butylimino)tris(pyrrolidino)phosphorane binds to the active site of enzymes that are involved in the glycolytic pathway, such as hexokinase, leading to inhibition of carbohydrate metabolism. This compound also inhibits the production of reactive oxygen species by binding with hydrogen and reducing their reactivity. (tert-Butylimino)tris(pyrrolidino)phosphorane has been shown to be stable under acidic conditions, making it a good candidate for use in pharmaceuticals.</p>Formula:C16H33N4PColor and Shape:Purple Clear LiquidMolecular weight:312.43 g/mol




