CAS 161192-22-9

4-Oxo-2-thioxo-3-thiazolidinepentanoic acid

Description:

4-Oxo-2-thioxo-3-thiazolidinepentanoic acid, identified by its CAS number 161192-22-9, is a heterocyclic compound featuring a thiazolidine ring. This compound is characterized by the presence of a thiazolidine structure, which includes sulfur and nitrogen atoms, contributing to its unique chemical properties. The "4-oxo" and "2-thioxo" functional groups indicate the presence of a ketone and a thioketone, respectively, which can influence its reactivity and potential applications in organic synthesis. The pentanoic acid moiety suggests that it has a five-carbon chain, which may affect its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features allow for potential interactions with various biological targets, and it may serve as a scaffold for the design of novel therapeutic agents. However, specific applications and biological effects would require further investigation through empirical studies.

Formula: C₈H₁₁NO₃S₂

InChI: InChI=1S/C8H11NO3S2/c10-6-5-14-8(13)9(6)4-2-1-3-7(11)12/h1-5H2,(H,11,12)

InChI key: InChIKey=KVEUMEOQMJZFRA-UHFFFAOYSA-N

SMILES: C(CCCC(O)=O)N1C(=O)CSC1=S

Synonyms:

• 3-Thiazolidinepentanoic acid, 4-oxo-2-thioxo-
• 4-Oxo-2-thioxo-3-thiazolidinepentanoic acid

5-(4-Oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanoic acid

CAS: 161192-22-9

Versatile small molecule scaffold

Formula: C₈H₁₁NO₃S₂

Purity: Min. 95%

Molecular weight: 233.3 g/mol

Ref: 3D-LGA19222