CAS 16128-88-4
:4-Ethoxy-2,5-dimethoxy-α-methylbenzeneethanamine
Description:
4-Ethoxy-2,5-dimethoxy-α-methylbenzeneethanamine, also known by its CAS number 16128-88-4, is a chemical compound that belongs to the class of substituted phenethylamines. This compound features a benzene ring with multiple methoxy and ethoxy substituents, which contribute to its unique chemical properties. The presence of the ethoxy group enhances its solubility in organic solvents, while the methoxy groups can influence its reactivity and interaction with biological systems. The α-methyl group in the structure suggests that it may exhibit stereoisomerism, potentially affecting its pharmacological activity. Compounds of this nature are often studied for their psychoactive properties and potential applications in medicinal chemistry. However, detailed studies on its specific biological effects, toxicity, and therapeutic potential may be limited. As with many organic compounds, proper handling and safety precautions are essential due to potential health risks associated with exposure.
Formula:C13H21NO3
InChI:InChI=1S/C13H21NO3/c1-5-17-13-8-11(15-3)10(6-9(2)14)7-12(13)16-4/h7-9H,5-6,14H2,1-4H3
InChI key:InChIKey=ITZLAXJQDMGDEO-UHFFFAOYSA-N
SMILES:C(C(C)N)C1=C(OC)C=C(OCC)C(OC)=C1
Synonyms:- 4-Ethoxy-2,5-dimethoxy-α-methylbenzeneethanamine
- Benzeneethanamine, 4-ethoxy-2,5-dimethoxy-α-methyl-
- (±)-1-(2,5-Dimethoxy-4-ethoxyphenyl)-2-aminopropane
- Phenethylamine, 4-ethoxy-2,5-dimethoxy-α-methyl-
- (±)-1-(4-Ethoxy-2,5-dimethoxyphenyl)-2-aminopropane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,5-Dimethoxy-4-ethoxyamphetamine Hydrochloride
CAS:Controlled ProductFormula:C13H21NO3Color and Shape:NeatMolecular weight:239.311
