CAS 161282-93-5
:[(E)-2-cyclopentylvinyl]boronic acid
Description:
[(E)-2-Cyclopentylvinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The compound features a cyclopentyl group attached to a vinyl moiety, indicating that it has a double bond in its structure, which contributes to its reactivity. The (E) configuration denotes that the highest priority substituents on either side of the double bond are on opposite sides, influencing its stereochemistry and potential interactions in reactions. Boronic acids are typically polar and can participate in hydrogen bonding due to the hydroxyl group, enhancing their solubility in polar solvents. This compound may be utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, to form carbon-carbon bonds, making it valuable in the synthesis of complex organic molecules. Its unique structural features and reactivity profile make it an important compound in synthetic organic chemistry.
Formula:C7H13BO2
InChI:InChI=1/C7H13BO2/c9-8(10)6-5-7-3-1-2-4-7/h5-7,9-10H,1-4H2/b6-5+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Boronic acid, [(1E)-2-cyclopentylethenyl]- (9CI)
CAS:Formula:C7H13BO2Purity:96%Color and Shape:SolidMolecular weight:139.98792-(Cyclopentyl)ethenyl-1-boronic acid
CAS:<p>2-(Cyclopentyl)ethenyl-1-boronic acid</p>Formula:C7H13BO2Purity:96%Color and Shape: white solidMolecular weight:139.99g/mol(E)-(2-Cyclopentylvinyl)boronic acid
CAS:Purity:96% mix TBC as stabilizerMolecular weight:139.9900055(E)-(2-Cyclopentylethenyl)boronic Acid
CAS:Controlled ProductFormula:C7H13BO2Color and Shape:NeatMolecular weight:139.99



