CAS 1613-34-9
:2-ethylquinoline
Description:
2-Ethylquinoline is an organic compound belonging to the class of quinolines, which are bicyclic aromatic compounds containing a fused benzene and pyridine ring. It is characterized by its ethyl group attached to the second position of the quinoline structure. This compound typically appears as a yellow to brown liquid with a distinctive aromatic odor. 2-Ethylquinoline is known for its relatively high boiling point and moderate solubility in organic solvents, while being less soluble in water. It exhibits properties typical of nitrogen-containing heterocycles, including potential biological activity, which has garnered interest in medicinal chemistry. Additionally, 2-ethylquinoline can participate in various chemical reactions, such as electrophilic substitutions and oxidation, making it a valuable intermediate in organic synthesis. Its applications extend to the fields of dyes, pharmaceuticals, and agrochemicals. Safety data indicates that, like many organic compounds, it should be handled with care due to potential health hazards, including skin and respiratory irritation.
Formula:C11H11N
InChI:InChI=1/C11H11N/c1-2-10-8-7-9-5-3-4-6-11(9)12-10/h3-8H,2H2,1H3
SMILES:CCc1ccc2ccccc2n1
Synonyms:- Ethylquinoline
- Quinoline, 2-Ethyl-
- 2-ETHYLQUINOLINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Ethylquinoline
CAS:2-Ethylquinoline is a compound that belongs to the group of alkenes. It can be prepared by reacting acetaldehyde with an amine in the presence of acid catalysts such as sulfuric acid or acetic acid. 2-Ethylquinoline has been shown to react with allylamine, forming an ether linkage. This reaction is facilitated by ultrasonic extraction and heating at reflux temperature for 12 hours, and then cooling to room temperature. The product obtained is purified via column chromatography using acetonitrile as a solvent. The magnetic resonance spectroscopy of 2-ethylquinoline reveals that it possesses a C–H bond and cyclic structure.
Formula:C11H11NPurity:Min. 95%Molecular weight:157.21 g/molRef: 3D-BAA61334
Discontinued product

