CAS 1613134-39-6

1H-1,2,3-Triazole-4-carboxylic acid, 1-(2-aminoethyl)-, methyl ester, hydrochloride (1:1)

Description:

1H-1,2,3-Triazole-4-carboxylic acid, 1-(2-aminoethyl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which contributes to its unique reactivity and biological properties. This compound features a carboxylic acid functional group and an aminoethyl side chain, which can facilitate interactions with biological targets, making it of interest in medicinal chemistry. The presence of the methyl ester indicates that it can undergo hydrolysis to release the corresponding carboxylic acid, potentially enhancing its bioavailability. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for pharmaceutical applications. The compound may exhibit various biological activities, including antimicrobial or anticancer properties, due to the triazole moiety's ability to interact with enzymes and receptors. Its specific applications and efficacy would depend on further studies and evaluations in biological systems. Overall, this compound represents a versatile scaffold in drug development and research.

Formula: C₆H₁₀N₄O₂·ClH

InChI: InChI=1S/C6H10N4O2.ClH/c1-12-6(11)5-4-10(3-2-7)9-8-5;/h4H,2-3,7H2,1H3;1H

InChI key: InChIKey=YBIZLUMVLRTTRQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CN(CCN)N=N1.Cl

Synonyms:

• 1H-1,2,3-Triazole-4-carboxylic acid, 1-(2-aminoethyl)-, methyl ester, hydrochloride (1:1)
• 1H-1,2,3-Triazole-4-carboxylic acid 1-(2-aminoethyl)-, methyl ester hydrochloride (1:1)

Methyl 1-(2-aminoethyl)-1H-1,2,3-triazole-4-carboxylate hydrochloride

CAS: 1613134-39-6

Versatile small molecule scaffold

Formula: C₆H₁₁ClN₄O₂

Purity: Min. 95%

Molecular weight: 206.63 g/mol

Ref: 3D-NPC13439