CAS 16135-41-4
:6,7-DIMETHOXY-1,4-DIHYDRO-3H-ISOCHROMEN-3-ONE
Description:
6,7-Dimethoxy-1,4-dihydro-3H-isochromen-3-one, with the CAS number 16135-41-4, is a chemical compound that belongs to the class of isoquinoline derivatives. This compound features a fused ring system that includes a chromenone structure, characterized by the presence of two methoxy groups at the 6 and 7 positions of the iso-chromenone framework. It typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, which may include antioxidant, anti-inflammatory, and anticancer properties. Its molecular structure allows for various interactions with biological targets, making it a subject of research in drug development. As with many organic compounds, proper handling and safety measures should be observed, as its specific toxicity and environmental impact may not be fully characterized.
Formula:C11H12O4
InChI:InChI=1/C11H12O4/c1-13-9-3-7-5-11(12)15-6-8(7)4-10(9)14-2/h3-4H,5-6H2,1-2H3
SMILES:COc1cc2CC(=O)OCc2cc1OC
Synonyms:- Buttpark 147\04-22
- 6,7-Dimethoxy-3-Isochromanone
- 6,7-Dimethoxy-3-Isochromen-3-One
- 6,7-Dimethoxyisochroman-3-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3H-2-Benzopyran-3-one, 1,4-dihydro-6,7-dimethoxy-
CAS:Formula:C11H12O4Purity:95%Color and Shape:SolidMolecular weight:208.21066,7-Dimethoxyisochroman-3-one
CAS:6,7-Dimethoxyisochroman-3-oneFormula:C11H12O4Purity:≥95%Color and Shape: yellow solidMolecular weight:208.21g/mol6,7-Dimethoxy-1,4-dihydro-3H-isochromen-3-one
CAS:6,7-Dimethoxy-1,4-dihydro-3H-isochromen-3-one is a hydrazide with the chemical formula C8H8N2O3. It belongs to the family of natural products and has the molecular weight of 172.15. 6,7-Dimethoxy-1,4-dihydro-3H-isochromen-3-one is an isoquinolone derivative that contains two methyl groups on carbons 6 and 7. The compound is a symmetric molecule that can be found as a hydroxy or methoxy derivative. It reacts with 3,4 dimethoxyphenylacetic acid to form yohimbane in the presence of an oxidizing agent such as electrochemical oxidation or maldi tof. 6,7 Dimethoxy 1,4 dihydro 3H isochromen 3 one was obtained from endohedral metalloful
Formula:C11H12O4Purity:Min. 95%Molecular weight:208.21 g/mol



