CymitQuimica logo

CAS 161373-43-9

:

4-Amino-6-fluoro-3-cinnolinecarboxylic acid

Description:
4-Amino-6-fluoro-3-cinnolinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cinnoline ring system, an amino group, and a fluoro substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the amino group suggests it may engage in hydrogen bonding, influencing its solubility and interaction with other molecules. The fluoro substituent can enhance lipophilicity and may affect the compound's pharmacokinetic properties. Additionally, the carboxylic acid functional group indicates acidic behavior, allowing for potential ionization in solution, which can further influence its reactivity and solubility. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe, given the structural features that can interact with biological targets. Overall, 4-Amino-6-fluoro-3-cinnolinecarboxylic acid represents a versatile structure with implications in various chemical and biological contexts.
Formula:C9H6FN3O2
InChI:InChI=1S/C9H6FN3O2/c10-4-1-2-6-5(3-4)7(11)8(9(14)15)13-12-6/h1-3H,(H2,11,12)(H,14,15)
InChI key:InChIKey=QBUGYSNCFMFXMD-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=NC1C(O)=O)C=CC(F)=C2
Synonyms:
  • 3-Cinnolinecarboxylic acid, 4-amino-6-fluoro-
  • 3-Cinnolinecarboxylicacid,4-amino-6-fluoro-(9CI)
  • 4-Amino-6-Fluorocinnoline-3-Carboxylic Acid
  • 4-Amino-6-fluoro-3-cinnolinecarboxylic acid
Found 4 products.