CAS 161373-44-0
:3-Cinnolinecarboxylic acid, 4-amino-7-fluoro-, hydrate
Description:
3-Cinnolinecarboxylic acid, 4-amino-7-fluoro-, hydrate is a chemical compound characterized by its unique structure, which includes a cinnoline ring system, a carboxylic acid functional group, an amino group, and a fluorine atom. The presence of the amino group suggests potential for hydrogen bonding and reactivity, while the carboxylic acid group contributes to its acidity and solubility in polar solvents. The fluorine atom can enhance the compound's biological activity and lipophilicity, making it of interest in pharmaceutical research. As a hydrate, it contains water molecules in its crystalline structure, which can influence its stability and solubility. This compound may exhibit various biological activities, potentially making it useful in medicinal chemistry. Its CAS number, 161373-44-0, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, this compound represents a blend of functional groups that may contribute to its chemical reactivity and potential applications in drug development.
Formula:C9H6FN3O2
InChI:InChI=1/C9H6FN3O2/c10-4-1-2-5-6(3-4)12-13-8(7(5)11)9(14)15/h1-3H,(H2,11,12)(H,14,15)
SMILES:c1cc2c(cc1F)nnc(c2N)C(=O)O
Synonyms:- 3-Cinnolinecarboxylicacid,4-amino-7-fluoro-(9CI)
- 4-Amino-7-Fluorocinnoline-3-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
