CAS 161373-45-1
:4-Amino-8-fluoro-3-cinnolinecarboxylic acid
Description:
4-Amino-8-fluoro-3-cinnolinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cinnoline ring system, an amino group, and a fluoro substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the amino group suggests it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The fluoro substituent can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological targets. Additionally, the carboxylic acid functional group indicates acidic behavior, allowing for protonation and deprotonation under varying pH conditions. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to the development of pharmaceuticals or agrochemicals. Overall, 4-Amino-8-fluoro-3-cinnolinecarboxylic acid presents a combination of functional groups that may confer diverse chemical and biological properties, making it a subject of interest in various research fields.
Formula:C9H6FN3O2
InChI:InChI=1S/C9H6FN3O2/c10-5-3-1-2-4-6(11)8(9(14)15)13-12-7(4)5/h1-3H,(H2,11,12)(H,14,15)
InChI key:InChIKey=NOIHXHCMSBSYKZ-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=NC1C(O)=O)C(F)=CC=C2
Synonyms:- 3-Cinnolinecarboxylic acid, 4-amino-8-fluoro-
- 3-Cinnolinecarboxylicacid,4-amino-8-fluoro-(9CI)
- 4-Amino-8-Fluorocinnoline-3-Carboxylic Acid
- 4-Amino-8-fluoro-3-cinnolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
