CAS 161373-47-3
:4-Amino-7-chloro-3-cinnolinecarboxylic acid
Description:
4-Amino-7-chloro-3-cinnolinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cinnoline ring system, an amino group, and a carboxylic acid functional group. This compound typically appears as a solid and is soluble in polar solvents, reflecting its polar functional groups. The presence of the amino group suggests potential basicity, while the carboxylic acid group contributes to its acidity. The chlorine substituent at the 7-position of the cinnoline ring can influence the compound's reactivity and biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which can be explored in research settings. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 4-Amino-7-chloro-3-cinnolinecarboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H6ClN3O2
InChI:InChI=1S/C9H6ClN3O2/c10-4-1-2-5-6(3-4)12-13-8(7(5)11)9(14)15/h1-3H,(H2,11,12)(H,14,15)
InChI key:InChIKey=BADWGFOQGQMHJZ-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=NC1C(O)=O)C=C(Cl)C=C2
Synonyms:- 3-Cinnolinecarboxylic acid, 4-amino-7-chloro-
- 4-Amino-7-chloro-3-cinnolinecarboxylic acid
- NSC 669311
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
