CymitQuimica logo

CAS 16139-79-0

:

Diphenylphsphonoacetic acid ethyl ester

Description:
Diphenylphosphonoacetic acid ethyl ester, with the CAS number 16139-79-0, is an organophosphorus compound characterized by the presence of a phosphonic acid moiety esterified with ethyl and diphenyl groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly as a reagent in the formation of phosphonate derivatives. The presence of the diphenyl group contributes to its stability and reactivity, making it useful in various chemical transformations. Additionally, the ethyl ester functionality enhances its solubility in organic solvents, facilitating its use in diverse chemical environments. As with many organophosphorus compounds, it may exhibit biological activity, necessitating careful handling and consideration of safety protocols. Overall, diphenylphosphonoacetic acid ethyl ester is a versatile compound in the field of synthetic organic chemistry.
Formula:C16H17O5P
InChI:InChI=1/C16H17O5P/c1-2-19-16(17)13-22(18,20-14-9-5-3-6-10-14)21-15-11-7-4-8-12-15/h3-12H,2,13H2,1H3
InChI key:UQMFCYBSUVRGNU-UHFFFAOYSA-N
SMILES:CCOC(=O)CP(=O)(Oc1ccccc1)Oc1ccccc1
Synonyms:
  • Ethyl (Diphenoxyphosphoryl)Acetate
Found 5 products.