CymitQuimica logo

CAS 1614-11-5

:

2-AMINOBENZOTRIAZOLE

Description:
2-Aminobenzotriazole (ABT) is an organic compound characterized by its triazole ring fused to a benzene ring, with an amino group (-NH2) attached to the benzene. It is a white to light yellow crystalline solid that is soluble in water and various organic solvents. ABT is known for its role as a chemical intermediate and is utilized in various applications, including as a reagent in organic synthesis and as a potential inhibitor in biochemical research. The presence of the amino group contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, 2-aminobenzotriazole has been studied for its potential as a pharmaceutical agent and in agricultural applications due to its ability to inhibit certain enzymes. However, safety and handling precautions are necessary, as it may pose health risks upon exposure. Overall, 2-aminobenzotriazole is a versatile compound with significant relevance in both industrial and research settings.
Formula:C6H6N4
InChI:InChI=1/C6H6N4/c7-10-8-5-3-1-2-4-6(5)9-10/h1-4H,7H2
InChI key:YYZVLEJDGSWXII-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)nn(N)n2
Synonyms:
  • 2-Benzotriazolamine
  • 2H-1,2,3-Benzotriazol-2-Amine
  • 2H-benzotriazol-2-amine
Found 4 products.